C17H26F3NO — CID 145108003
4,4-dimethyl-1-[2-[(2E,4E)-4-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethyl]piperidine (PubChem CID 145108003) has the molecular formula C17H26F3NO and a molecular weight of 317.40 g/mol. Its IUPAC name is 4,4-dimethyl-1-[2-[(2E,4E)-4-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethyl]piperidine.
| Compound Name | 4,4-dimethyl-1-[2-[(2E,4E)-4-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethyl]piperidine |
|---|---|
| PubChem CID | 145108003 |
| Molecular Formula | C17H26F3NO |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 4,4-dimethyl-1-[2-[(2E,4E)-4-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethyl]piperidine |
| SMILES | C=C/C=C(C(=C/C)\OCCN1CCC(C)(C)CC1)/C(F)(F)F |
| InChI | InChI=1S/C17H26F3NO/c1-5-7-14(17(18,19)20)15(6-2)22-13-12-21-10-8-16(3,4)9-11-21/h5-7H,1,8-13H2,2-4H3/b14-7+,15-6+ |
| InChIKey | GMZVDGPGQXKCGF-UWQNIFAVSA-N |
| XLogP | 4.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|