C11H12N2O2 — CID 145108436
6-[(3E)-hexa-1,3,5-trien-3-yl]-1-methylpyrimidine-2,4-dione (PubChem CID 145108436) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-[(3E)-hexa-1,3,5-trien-3-yl]-1-methylpyrimidine-2,4-dione.
| Compound Name | 6-[(3E)-hexa-1,3,5-trien-3-yl]-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 145108436 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 6-[(3E)-hexa-1,3,5-trien-3-yl]-1-methylpyrimidine-2,4-dione |
| SMILES | C=C/C=C(\C=C)c1cc(=O)[nH]c(=O)n1C |
| InChI | InChI=1S/C11H12N2O2/c1-4-6-8(5-2)9-7-10(14)12-11(15)13(9)3/h4-7H,1-2H2,3H3,(H,12,14,15)/b8-6+ |
| InChIKey | SGAKUWIRVNHNBG-SOFGYWHQSA-N |
| XLogP | 0.83 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|