C16H14F4O2 — CID 145108438
[3-fluoro-5-methyl-4-[4-methyl-3-(trifluoromethyl)phenoxy]phenyl]methanol (PubChem CID 145108438) has the molecular formula C16H14F4O2 and a molecular weight of 314.28 g/mol. Its IUPAC name is [3-fluoro-5-methyl-4-[4-methyl-3-(trifluoromethyl)phenoxy]phenyl]methanol.
| Compound Name | [3-fluoro-5-methyl-4-[4-methyl-3-(trifluoromethyl)phenoxy]phenyl]methanol |
|---|---|
| PubChem CID | 145108438 |
| Molecular Formula | C16H14F4O2 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | [3-fluoro-5-methyl-4-[4-methyl-3-(trifluoromethyl)phenoxy]phenyl]methanol |
| SMILES | Cc1ccc(Oc2c(C)cc(CO)cc2F)cc1C(F)(F)F |
| InChI | InChI=1S/C16H14F4O2/c1-9-3-4-12(7-13(9)16(18,19)20)22-15-10(2)5-11(8-21)6-14(15)17/h3-7,21H,8H2,1-2H3 |
| InChIKey | WGRAMEPZTKYMLA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |