C32H43N5O3 — CID 145109171
N-[6-[4-(1-aminocyclopropyl)phenyl]-5-phenylpyridazin-3-yl]acetamide;N-cyclohexyl-N-methylformamide;methoxyethane (PubChem CID 145109171) has the molecular formula C32H43N5O3 and a molecular weight of 545.73 g/mol. Its IUPAC name is N-[6-[4-(1-aminocyclopropyl)phenyl]-5-phenylpyridazin-3-yl]acetamide;N-cyclohexyl-N-methylformamide;methoxyethane.
| Compound Name | N-[6-[4-(1-aminocyclopropyl)phenyl]-5-phenylpyridazin-3-yl]acetamide;N-cyclohexyl-N-methylformamide;methoxyethane |
|---|---|
| PubChem CID | 145109171 |
| Molecular Formula | C32H43N5O3 |
| Molecular Weight | 545.73 g/mol |
| Exact Mass | 545.34 |
| IUPAC Name | N-[6-[4-(1-aminocyclopropyl)phenyl]-5-phenylpyridazin-3-yl]acetamide;N-cyclohexyl-N-methylformamide;methoxyethane |
| SMILES | CC(=O)Nc1cc(-c2ccccc2)c(-c2ccc(C3(N)CC3)cc2)nn1.CCOC.CN(C=O)C1CCCCC1 |
| InChI | InChI=1S/C21H20N4O.C8H15NO.C3H8O/c1-14(26)23-19-13-18(15-5-3-2-4-6-15)20(25-24-19)16-7-9-17(10-8-16)21(22)11-12-21;1-9(7-10)8-5-3-2-4-6-8;1-3-4-2/h2-10,13H,11-12,22H2,1H3,(H,23,24,26);7-8H,2-6H2,1H3;3H2,1-2H3 |
| InChIKey | XXNVWJRAQUCHIC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.73 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|