C73H54N2 — CID 145109868
3-cyclohexa-1,3-dien-1-yl-6-[5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-phenyl-9-(4-phenylphenyl)carbazol-1-yl]-1-phenyl-9-(3-phenylphenyl)carbazole (PubChem CID 145109868) has the molecular formula C73H54N2 and a molecular weight of 959.25 g/mol. Its IUPAC name is 3-cyclohexa-1,3-dien-1-yl-6-[5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-phenyl-9-(4-phenylphenyl)carbazol-1-yl]-1-phenyl-9-(3-phenylphenyl)carbazole.
| Compound Name | 3-cyclohexa-1,3-dien-1-yl-6-[5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-phenyl-9-(4-phenylphenyl)carbazol-1-yl]-1-phenyl-9-(3-phenylphenyl)carbazole |
|---|---|
| PubChem CID | 145109868 |
| Molecular Formula | C73H54N2 |
| Molecular Weight | 959.25 g/mol |
| Exact Mass | 958.43 |
| IUPAC Name | 3-cyclohexa-1,3-dien-1-yl-6-[5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-phenyl-9-(4-phenylphenyl)carbazol-1-yl]-1-phenyl-9-(3-phenylphenyl)carbazole |
| SMILES | C=C/C(=C\C=C/C)c1ccc(-c2ccccc2)c2c1c1cccc(-c3ccc4c(c3)c3cc(C5=CC=CCC5)cc(-c5ccccc5)c3n4-c3cccc(-c4ccccc4)c3)c1n2-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C73H54N2/c1-3-5-23-50(4-2)62-43-44-64(55-30-17-9-18-31-55)73-70(62)65-37-22-36-63(71(65)75(73)60-41-38-54(39-42-60)51-24-11-6-12-25-51)58-40-45-69-67(47-58)68-49-59(53-28-15-8-16-29-53)48-66(56-32-19-10-20-33-56)72(68)74(69)61-35-21-34-57(46-61)52-26-13-7-14-27-52/h3-15,17-28,30-49H,2,16,29H2,1H3/b5-3-,50-23+ |
| InChIKey | SEAGFPLWRJUUDX-RFKBNYBASA-N |
| XLogP | 20.09 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.25 |
| LogP ≤ 5 | 20.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|