C17H17NO4 — CID 14511064
(3S,4R)-3-hydroxy-2,2-dimethyl-4-(2-oxo-1-pyridinyl)-3,4-dihydrochromene-6-carbaldehyde (PubChem CID 14511064) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-2,2-dimethyl-4-(2-oxo-1-pyridinyl)-3,4-dihydrochromene-6-carbaldehyde.
| Compound Name | (3S,4R)-3-hydroxy-2,2-dimethyl-4-(2-oxo-1-pyridinyl)-3,4-dihydrochromene-6-carbaldehyde |
|---|---|
| PubChem CID | 14511064 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (3S,4R)-3-hydroxy-2,2-dimethyl-4-(2-oxo-1-pyridinyl)-3,4-dihydrochromene-6-carbaldehyde |
| SMILES | CC1(C)Oc2ccc(C=O)cc2[C@@H](n2ccccc2=O)[C@@H]1O |
| InChI | InChI=1S/C17H17NO4/c1-17(2)16(21)15(18-8-4-3-5-14(18)20)12-9-11(10-19)6-7-13(12)22-17/h3-10,15-16,21H,1-2H3/t15-,16+/m1/s1 |
| InChIKey | PIECTRPULLLMKF-CVEARBPZSA-N |
| XLogP | 1.78 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|