About benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole
benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole (PubChem CID 145110900) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole |
| PubChem CID | 145110900 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole |
| SMILES | C1CNC(C2CC2)=N1.c1ccccc1 |
| InChI | InChI=1S/C6H10N2.C6H6/c1-2-5(1)6-7-3-4-8-6;1-2-4-6-5-3-1/h5H,1-4H2,(H,7,8);1-6H |
| InChIKey | BRISEPVJTFMHCX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole?
The IUPAC name of benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole (CID 145110900) is benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole.
What is the SMILES notation for benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole?
The canonical SMILES for benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole is C1CNC(C2CC2)=N1.c1ccccc1.
What is the InChIKey of benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole?
The InChIKey is BRISEPVJTFMHCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C6H6/c1-2-5(1)6-7-3-4-8-6;1-2-4-6-5-3-1/h5H,1-4H2,(H,7,8);1-6H.
What are the key properties of benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole?
benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole has a molecular weight of 188.27 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 145110900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).