C12H16N2 — CID 145110900
benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole (PubChem CID 145110900) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole.
| Compound Name | benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 145110900 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | benzene;2-cyclopropyl-4,5-dihydro-1H-imidazole |
| SMILES | C1CNC(C2CC2)=N1.c1ccccc1 |
| InChI | InChI=1S/C6H10N2.C6H6/c1-2-5(1)6-7-3-4-8-6;1-2-4-6-5-3-1/h5H,1-4H2,(H,7,8);1-6H |
| InChIKey | BRISEPVJTFMHCX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |