C15H19N3O4 — CID 14511094
(3S,4R)-4-(2-iminopyrrolidin-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol (PubChem CID 14511094) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is (3S,4R)-4-(2-iminopyrrolidin-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol.
| Compound Name | (3S,4R)-4-(2-iminopyrrolidin-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 14511094 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (3S,4R)-4-(2-iminopyrrolidin-1-yl)-2,2-dimethyl-6-nitro-3,4-dihydrochromen-3-ol |
| SMILES | [H]/N=C1\CCCN1[C@@H]1c2cc([N+](=O)[O-])ccc2OC(C)(C)[C@H]1O |
| InChI | InChI=1S/C15H19N3O4/c1-15(2)14(19)13(17-7-3-4-12(17)16)10-8-9(18(20)21)5-6-11(10)22-15/h5-6,8,13-14,16,19H,3-4,7H2,1-2H3/b16-12+/t13-,14+/m1/s1 |
| InChIKey | XZFYBBLMCVJSGL-XJRDAQMOSA-N |
| XLogP | 2.24 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|