About 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine
2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine (PubChem CID 145110985) has the molecular formula C10H16F3N
and a molecular weight of 207.24 g/mol. Its IUPAC name is 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine.
Molecular Properties
| Compound Name | 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine |
| PubChem CID | 145110985 |
| Molecular Formula | C10H16F3N |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine |
| SMILES | C/C(=C/CCC1CCCN1)C(F)(F)F |
| InChI | InChI=1S/C10H16F3N/c1-8(10(11,12)13)4-2-5-9-6-3-7-14-9/h4,9,14H,2-3,5-7H2,1H3/b8-4- |
| InChIKey | PZIFDJNYTPRQJN-YWEYNIOJSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine?
The IUPAC name of 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine (CID 145110985) is 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine.
What is the SMILES notation for 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine?
The canonical SMILES for 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine is C/C(=C/CCC1CCCN1)C(F)(F)F.
What is the InChIKey of 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine?
The InChIKey is PZIFDJNYTPRQJN-YWEYNIOJSA-N. The full InChI is InChI=1S/C10H16F3N/c1-8(10(11,12)13)4-2-5-9-6-3-7-14-9/h4,9,14H,2-3,5-7H2,1H3/b8-4-.
What are the key properties of 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine?
2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine has a molecular weight of 207.24 g/mol, XLogP of 3.03, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]pyrrolidine is sourced from PubChem (CID 145110985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).