C12H22F5N — CID 145111191
(E)-N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-methylhept-5-en-2-amine;ethane (PubChem CID 145111191) has the molecular formula C12H22F5N and a molecular weight of 275.31 g/mol. Its IUPAC name is (E)-N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-methylhept-5-en-2-amine;ethane.
| Compound Name | (E)-N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-methylhept-5-en-2-amine;ethane |
|---|---|
| PubChem CID | 145111191 |
| Molecular Formula | C12H22F5N |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (E)-N-(2,2-difluoroethyl)-7,7,7-trifluoro-6-methylhept-5-en-2-amine;ethane |
| SMILES | C/C(=C\CCC(C)NCC(F)F)C(F)(F)F.CC |
| InChI | InChI=1S/C10H16F5N.C2H6/c1-7(10(13,14)15)4-3-5-8(2)16-6-9(11)12;1-2/h4,8-9,16H,3,5-6H2,1-2H3;1-2H3/b7-4+; |
| InChIKey | KBCBXQPVGHBQAU-KQGICBIGSA-N |
| XLogP | 4.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|