About 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde
3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde (PubChem CID 145111309) has the molecular formula C8H4FNO2S
and a molecular weight of 197.19 g/mol. Its IUPAC name is 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde.
Molecular Properties
| Compound Name | 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde |
| PubChem CID | 145111309 |
| Molecular Formula | C8H4FNO2S |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde |
| SMILES | O=Cc1cc(-c2ccc(F)s2)no1 |
| InChI | InChI=1S/C8H4FNO2S/c9-8-2-1-7(13-8)6-3-5(4-11)12-10-6/h1-4H |
| InChIKey | CLYQYDKUBGJULH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde?
The IUPAC name of 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde (CID 145111309) is 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde.
What is the SMILES notation for 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde?
The canonical SMILES for 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde is O=Cc1cc(-c2ccc(F)s2)no1.
What is the InChIKey of 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde?
The InChIKey is CLYQYDKUBGJULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4FNO2S/c9-8-2-1-7(13-8)6-3-5(4-11)12-10-6/h1-4H.
What are the key properties of 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde?
3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde has a molecular weight of 197.19 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-fluorothiophen-2-yl)-1,2-oxazole-5-carbaldehyde is sourced from PubChem (CID 145111309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).