C26H24N6 — CID 145111755
(E)-3-[4-[4-amino-2-[(3,5-dimethyl-2-pyridinyl)amino]quinazolin-8-yl]-3,5-dimethylphenyl]prop-2-enenitrile (PubChem CID 145111755) has the molecular formula C26H24N6 and a molecular weight of 420.52 g/mol. Its IUPAC name is (E)-3-[4-[4-amino-2-[(3,5-dimethyl-2-pyridinyl)amino]quinazolin-8-yl]-3,5-dimethylphenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[4-amino-2-[(3,5-dimethyl-2-pyridinyl)amino]quinazolin-8-yl]-3,5-dimethylphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 145111755 |
| Molecular Formula | C26H24N6 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (E)-3-[4-[4-amino-2-[(3,5-dimethyl-2-pyridinyl)amino]quinazolin-8-yl]-3,5-dimethylphenyl]prop-2-enenitrile |
| SMILES | Cc1cnc(Nc2nc(N)c3cccc(-c4c(C)cc(/C=C/C#N)cc4C)c3n2)c(C)c1 |
| InChI | InChI=1S/C26H24N6/c1-15-11-18(4)25(29-14-15)32-26-30-23-20(8-5-9-21(23)24(28)31-26)22-16(2)12-19(7-6-10-27)13-17(22)3/h5-9,11-14H,1-4H3,(H3,28,29,30,31,32)/b7-6+ |
| InChIKey | MRZYSVLYCBAZHO-VOTSOKGWSA-N |
| XLogP | 5.79 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|