About ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine
ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine (PubChem CID 145111805) has the molecular formula C11H22NO2P
and a molecular weight of 231.28 g/mol. Its IUPAC name is ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine.
Molecular Properties
| Compound Name | ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine |
| PubChem CID | 145111805 |
| Molecular Formula | C11H22NO2P |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine |
| SMILES | C=C/C(=C\N=C)COP(C)OCC.CC |
| InChI | InChI=1S/C9H16NO2P.C2H6/c1-5-9(7-10-3)8-12-13(4)11-6-2;1-2/h5,7H,1,3,6,8H2,2,4H3;1-2H3/b9-7+; |
| InChIKey | NBKUOQBIJKZPSR-BXTVWIJMSA-N |
| XLogP | 3.78 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine?
The IUPAC name of ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine (CID 145111805) is ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine.
What is the SMILES notation for ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine?
The canonical SMILES for ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine is C=C/C(=C\N=C)COP(C)OCC.CC.
What is the InChIKey of ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine?
The InChIKey is NBKUOQBIJKZPSR-BXTVWIJMSA-N. The full InChI is InChI=1S/C9H16NO2P.C2H6/c1-5-9(7-10-3)8-12-13(4)11-6-2;1-2/h5,7H,1,3,6,8H2,2,4H3;1-2H3/b9-7+;.
What are the key properties of ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine?
ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine has a molecular weight of 231.28 g/mol, XLogP of 3.78, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(1E)-2-[[ethoxy(methyl)phosphanyl]oxymethyl]buta-1,3-dienyl]methanimine is sourced from PubChem (CID 145111805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).