C32H31F3N6O4 — CID 145112469
5-[8-amino-1-[2-ethoxy-4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,4,7-trimethyltricyclo[3.1.1.03,6]heptane-2-carboxylic acid (PubChem CID 145112469) has the molecular formula C32H31F3N6O4 and a molecular weight of 620.63 g/mol. Its IUPAC name is 5-[8-amino-1-[2-ethoxy-4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,4,7-trimethyltricyclo[3.1.1.03,6]heptane-2-carboxylic acid.
| Compound Name | 5-[8-amino-1-[2-ethoxy-4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,4,7-trimethyltricyclo[3.1.1.03,6]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 145112469 |
| Molecular Formula | C32H31F3N6O4 |
| Molecular Weight | 620.63 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | 5-[8-amino-1-[2-ethoxy-4-[[4-(trifluoromethyl)-2-pyridinyl]carbamoyl]phenyl]imidazo[1,5-a]pyrazin-3-yl]-2,4,7-trimethyltricyclo[3.1.1.03,6]heptane-2-carboxylic acid |
| SMILES | CCOc1cc(C(=O)Nc2cc(C(F)(F)F)ccn2)ccc1-c1nc(C23C(C)C4C2C(C3C)C4(C)C(=O)O)n2ccnc(N)c12 |
| InChI | InChI=1S/C32H31F3N6O4/c1-5-45-19-12-16(27(42)39-20-13-17(8-9-37-20)32(33,34)35)6-7-18(19)24-25-26(36)38-10-11-41(25)28(40-24)31-14(2)21-23(31)22(15(31)3)30(21,4)29(43)44/h6-15,21-23H,5H2,1-4H3,(H2,36,38)(H,43,44)(H,37,39,42) |
| InChIKey | ZACUFSJGIVCPHY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 144.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |