C26H31N3O5S — CID 145113394
ethane;[4-[4-[(5-hydroxy-2-nitrophenyl)methyl]piperazin-1-yl]phenyl] 4-methylbenzenesulfinate (PubChem CID 145113394) has the molecular formula C26H31N3O5S and a molecular weight of 497.62 g/mol. Its IUPAC name is ethane;[4-[4-[(5-hydroxy-2-nitrophenyl)methyl]piperazin-1-yl]phenyl] 4-methylbenzenesulfinate.
| Compound Name | ethane;[4-[4-[(5-hydroxy-2-nitrophenyl)methyl]piperazin-1-yl]phenyl] 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 145113394 |
| Molecular Formula | C26H31N3O5S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | ethane;[4-[4-[(5-hydroxy-2-nitrophenyl)methyl]piperazin-1-yl]phenyl] 4-methylbenzenesulfinate |
| SMILES | CC.Cc1ccc(S(=O)Oc2ccc(N3CCN(Cc4cc(O)ccc4[N+](=O)[O-])CC3)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O5S.C2H6/c1-18-2-9-23(10-3-18)33(31)32-22-7-4-20(5-8-22)26-14-12-25(13-15-26)17-19-16-21(28)6-11-24(19)27(29)30;1-2/h2-11,16,28H,12-15,17H2,1H3;1-2H3 |
| InChIKey | VSLJENIHJJVDPX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|