About ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine
ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine (PubChem CID 145113577) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine.
Molecular Properties
| Compound Name | ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine |
| PubChem CID | 145113577 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine |
| SMILES | C=C/C=C\C(=C/C=C)CN=C(N)N.CC |
| InChI | InChI=1S/C10H15N3.C2H6/c1-3-5-7-9(6-4-2)8-13-10(11)12;1-2/h3-7H,1-2,8H2,(H4,11,12,13);1-2H3/b7-5-,9-6+; |
| InChIKey | JGBPVPLJSUZIOG-UKRQJTKBSA-N |
| XLogP | 2.14 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine?
The IUPAC name of ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine (CID 145113577) is ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine.
What is the SMILES notation for ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine?
The canonical SMILES for ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine is C=C/C=C\C(=C/C=C)CN=C(N)N.CC.
What is the InChIKey of ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine?
The InChIKey is JGBPVPLJSUZIOG-UKRQJTKBSA-N. The full InChI is InChI=1S/C10H15N3.C2H6/c1-3-5-7-9(6-4-2)8-13-10(11)12;1-2/h3-7H,1-2,8H2,(H4,11,12,13);1-2H3/b7-5-,9-6+;.
What are the key properties of ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine?
ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine has a molecular weight of 207.32 g/mol, XLogP of 2.14, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[(2E,3Z)-2-prop-2-enylidenehexa-3,5-dienyl]guanidine is sourced from PubChem (CID 145113577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).