C6H10F3NO2 — CID 14511496
2,2,2-trifluoro-N-[(2S)-1-methoxypropan-2-yl]acetamide (PubChem CID 14511496) has the molecular formula C6H10F3NO2 and a molecular weight of 185.14 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(2S)-1-methoxypropan-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(2S)-1-methoxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 14511496 |
| Molecular Formula | C6H10F3NO2 |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[(2S)-1-methoxypropan-2-yl]acetamide |
| SMILES | COC[C@H](C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO2/c1-4(3-12-2)10-5(11)6(7,8)9/h4H,3H2,1-2H3,(H,10,11)/t4-/m0/s1 |
| InChIKey | IFSQENPOGRZXMH-BYPYZUCNSA-N |
| XLogP | 0.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |