About 10-methyl-8-propoxyoxecan-2-one;phenol
10-methyl-8-propoxyoxecan-2-one;phenol (PubChem CID 145114995) has the molecular formula C19H30O4
and a molecular weight of 322.44 g/mol. Its IUPAC name is 10-methyl-8-propoxyoxecan-2-one;phenol.
Molecular Properties
| Compound Name | 10-methyl-8-propoxyoxecan-2-one;phenol |
| PubChem CID | 145114995 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 10-methyl-8-propoxyoxecan-2-one;phenol |
| SMILES | CCCOC1CCCCCC(=O)OC(C)C1.Oc1ccccc1 |
| InChI | InChI=1S/C13H24O3.C6H6O/c1-3-9-15-12-7-5-4-6-8-13(14)16-11(2)10-12;7-6-4-2-1-3-5-6/h11-12H,3-10H2,1-2H3;1-5,7H |
| InChIKey | UXUPOWOJIIZQRV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 10-methyl-8-propoxyoxecan-2-one;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-8-propoxyoxecan-2-one;phenol?
The IUPAC name of 10-methyl-8-propoxyoxecan-2-one;phenol (CID 145114995) is 10-methyl-8-propoxyoxecan-2-one;phenol.
What is the SMILES notation for 10-methyl-8-propoxyoxecan-2-one;phenol?
The canonical SMILES for 10-methyl-8-propoxyoxecan-2-one;phenol is CCCOC1CCCCCC(=O)OC(C)C1.Oc1ccccc1.
What is the InChIKey of 10-methyl-8-propoxyoxecan-2-one;phenol?
The InChIKey is UXUPOWOJIIZQRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3.C6H6O/c1-3-9-15-12-7-5-4-6-8-13(14)16-11(2)10-12;7-6-4-2-1-3-5-6/h11-12H,3-10H2,1-2H3;1-5,7H.
What are the key properties of 10-methyl-8-propoxyoxecan-2-one;phenol?
10-methyl-8-propoxyoxecan-2-one;phenol has a molecular weight of 322.44 g/mol, XLogP of 4.46, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-8-propoxyoxecan-2-one;phenol is sourced from PubChem (CID 145114995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).