C11H9F3O2 — CID 14511517
2,3-dihydro-1H-inden-1-yl 2,2,2-trifluoroacetate (PubChem CID 14511517) has the molecular formula C11H9F3O2 and a molecular weight of 230.18 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-yl 2,2,2-trifluoroacetate.
| Compound Name | 2,3-dihydro-1H-inden-1-yl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 14511517 |
| Molecular Formula | C11H9F3O2 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-yl 2,2,2-trifluoroacetate |
| SMILES | O=C(OC1CCc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C11H9F3O2/c12-11(13,14)10(15)16-9-6-5-7-3-1-2-4-8(7)9/h1-4,9H,5-6H2 |
| InChIKey | IIFISZKINOHEIW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |