C15H21NO7 — CID 145115896
ethane;(E)-N-methoxy-N-methyl-3-(2,2,3,3-tetrahydroxy-1-benzofuran-4-yl)prop-2-enamide (PubChem CID 145115896) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is ethane;(E)-N-methoxy-N-methyl-3-(2,2,3,3-tetrahydroxy-1-benzofuran-4-yl)prop-2-enamide.
| Compound Name | ethane;(E)-N-methoxy-N-methyl-3-(2,2,3,3-tetrahydroxy-1-benzofuran-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 145115896 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | ethane;(E)-N-methoxy-N-methyl-3-(2,2,3,3-tetrahydroxy-1-benzofuran-4-yl)prop-2-enamide |
| SMILES | CC.CON(C)C(=O)/C=C/c1cccc2c1C(O)(O)C(O)(O)O2 |
| InChI | InChI=1S/C13H15NO7.C2H6/c1-14(20-2)10(15)7-6-8-4-3-5-9-11(8)12(16,17)13(18,19)21-9;1-2/h3-7,16-19H,1-2H3;1-2H3/b7-6+; |
| InChIKey | JHIITIANRLSDHW-UHDJGPCESA-N |
| XLogP | -0.09 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|