About 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile
6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile (PubChem CID 145116179) has the molecular formula C13H12FN3O
and a molecular weight of 245.26 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile |
| PubChem CID | 145116179 |
| Molecular Formula | C13H12FN3O |
| Molecular Weight | 245.26 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile |
| SMILES | N#Cc1cccc(F)c1.Oc1ncn2c1CCC2 |
| InChI | InChI=1S/C7H4FN.C6H8N2O/c8-7-3-1-2-6(4-7)5-9;9-6-5-2-1-3-8(5)4-7-6/h1-4H;4,9H,1-3H2 |
| InChIKey | QHZQWVJULGMGBW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile (CID 145116179) is 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile is N#Cc1cccc(F)c1.Oc1ncn2c1CCC2.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile?
The InChIKey is QHZQWVJULGMGBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN.C6H8N2O/c8-7-3-1-2-6(4-7)5-9;9-6-5-2-1-3-8(5)4-7-6/h1-4H;4,9H,1-3H2.
What are the key properties of 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile?
6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile has a molecular weight of 245.26 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-1-ol;3-fluorobenzonitrile is sourced from PubChem (CID 145116179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).