C8H10IN3O — CID 145116229
iodomethane;6-methyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (PubChem CID 145116229) has the molecular formula C8H10IN3O and a molecular weight of 291.09 g/mol. Its IUPAC name is iodomethane;6-methyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one.
| Compound Name | iodomethane;6-methyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 145116229 |
| Molecular Formula | C8H10IN3O |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | iodomethane;6-methyl-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| SMILES | CI.Cc1cc2c(=O)[nH]cnn2c1 |
| InChI | InChI=1S/C7H7N3O.CH3I/c1-5-2-6-7(11)8-4-9-10(6)3-5;1-2/h2-4H,1H3,(H,8,9,11);1H3 |
| InChIKey | BNVSRPONGIZYAA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|