C20H17N3O3S2 — CID 145116453
2-[3-[(4-aminosulfanylphenyl)methyl]-6-(hydroxymethyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 145116453) has the molecular formula C20H17N3O3S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-[3-[(4-aminosulfanylphenyl)methyl]-6-(hydroxymethyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-[(4-aminosulfanylphenyl)methyl]-6-(hydroxymethyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 145116453 |
| Molecular Formula | C20H17N3O3S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 2-[3-[(4-aminosulfanylphenyl)methyl]-6-(hydroxymethyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | NSc1ccc(Cc2cn(-c3nc(C(=O)O)cs3)c3cc(CO)ccc23)cc1 |
| InChI | InChI=1S/C20H17N3O3S2/c21-28-15-4-1-12(2-5-15)7-14-9-23(20-22-17(11-27-20)19(25)26)18-8-13(10-24)3-6-16(14)18/h1-6,8-9,11,24H,7,10,21H2,(H,25,26) |
| InChIKey | WUJUSFWAAMJYNA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|