About CID 145116484
CID 145116484 (PubChem CID 145116484) has the molecular formula C29H22F3N4O4S2+
and a molecular weight of 611.65 g/mol.
Molecular Properties
| Compound Name | CID 145116484 |
| PubChem CID | 145116484 |
| Molecular Formula | C29H22F3N4O4S2+ |
| Molecular Weight | 611.65 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | — |
| SMILES | N[S+](=O)(O)c1ccc(Cc2c(-c3ccc(F)c(-c4ccc(F)cc4)c3)nn(-c3nc(C(=O)O)cs3)c2C2CC2)c(F)c1 |
| InChI | InChI=1S/C29H21F3N4O4S2/c30-19-7-3-15(4-8-19)21-12-18(6-10-23(21)31)26-22(11-17-5-9-20(13-24(17)32)42(33,39)40)27(16-1-2-16)36(35-26)29-34-25(14-41-29)28(37)38/h3-10,12-14,16H,1-2,11H2,(H3-,33,37,38,39,40)/p+1 |
| InChIKey | CTGREQSPTBWIEQ-UHFFFAOYSA-O |
| XLogP | 6.45 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 611.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 145116484 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145116484?
The IUPAC name of CID 145116484 (CID 145116484) is not available.
What is the SMILES notation for CID 145116484?
The canonical SMILES for CID 145116484 is N[S+](=O)(O)c1ccc(Cc2c(-c3ccc(F)c(-c4ccc(F)cc4)c3)nn(-c3nc(C(=O)O)cs3)c2C2CC2)c(F)c1.
What is the InChIKey of CID 145116484?
The InChIKey is CTGREQSPTBWIEQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C29H21F3N4O4S2/c30-19-7-3-15(4-8-19)21-12-18(6-10-23(21)31)26-22(11-17-5-9-20(13-24(17)32)42(33,39)40)27(16-1-2-16)36(35-26)29-34-25(14-41-29)28(37)38/h3-10,12-14,16H,1-2,11H2,(H3-,33,37,38,39,40)/p+1.
What are the key properties of CID 145116484?
CID 145116484 has a molecular weight of 611.65 g/mol, XLogP of 6.45, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145116484 is sourced from PubChem (CID 145116484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).