C26H20FN3O2S2 — CID 145116571
2-[3-[(4-aminosulfanylphenyl)methyl]-5-[(2-fluorophenyl)methyl]indol-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 145116571) has the molecular formula C26H20FN3O2S2 and a molecular weight of 489.60 g/mol. Its IUPAC name is 2-[3-[(4-aminosulfanylphenyl)methyl]-5-[(2-fluorophenyl)methyl]indol-1-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-[(4-aminosulfanylphenyl)methyl]-5-[(2-fluorophenyl)methyl]indol-1-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 145116571 |
| Molecular Formula | C26H20FN3O2S2 |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 2-[3-[(4-aminosulfanylphenyl)methyl]-5-[(2-fluorophenyl)methyl]indol-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | NSc1ccc(Cc2cn(-c3nc(C(=O)O)cs3)c3ccc(Cc4ccccc4F)cc23)cc1 |
| InChI | InChI=1S/C26H20FN3O2S2/c27-22-4-2-1-3-18(22)12-17-7-10-24-21(13-17)19(11-16-5-8-20(34-28)9-6-16)14-30(24)26-29-23(15-33-26)25(31)32/h1-10,13-15H,11-12,28H2,(H,31,32) |
| InChIKey | RNMBHGGVDNKASQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|