C25H18FN3O2S2 — CID 145116594
2-[3-[(4-aminosulfanylphenyl)methyl]-5-(2-fluorophenyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 145116594) has the molecular formula C25H18FN3O2S2 and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-[3-[(4-aminosulfanylphenyl)methyl]-5-(2-fluorophenyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[3-[(4-aminosulfanylphenyl)methyl]-5-(2-fluorophenyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 145116594 |
| Molecular Formula | C25H18FN3O2S2 |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 2-[3-[(4-aminosulfanylphenyl)methyl]-5-(2-fluorophenyl)indol-1-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | NSc1ccc(Cc2cn(-c3nc(C(=O)O)cs3)c3ccc(-c4ccccc4F)cc23)cc1 |
| InChI | InChI=1S/C25H18FN3O2S2/c26-21-4-2-1-3-19(21)16-7-10-23-20(12-16)17(11-15-5-8-18(33-27)9-6-15)13-29(23)25-28-22(14-32-25)24(30)31/h1-10,12-14H,11,27H2,(H,30,31) |
| InChIKey | OPDWACFRDMHIKI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|