C11H16BrFN2O — CID 145116695
1-[(2Z,4Z,6E)-7-bromo-2-fluoroocta-2,4,6-trien-3-yl]-3-ethylurea (PubChem CID 145116695) has the molecular formula C11H16BrFN2O and a molecular weight of 291.16 g/mol. Its IUPAC name is 1-[(2Z,4Z,6E)-7-bromo-2-fluoroocta-2,4,6-trien-3-yl]-3-ethylurea.
| Compound Name | 1-[(2Z,4Z,6E)-7-bromo-2-fluoroocta-2,4,6-trien-3-yl]-3-ethylurea |
|---|---|
| PubChem CID | 145116695 |
| Molecular Formula | C11H16BrFN2O |
| Molecular Weight | 291.16 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 1-[(2Z,4Z,6E)-7-bromo-2-fluoroocta-2,4,6-trien-3-yl]-3-ethylurea |
| SMILES | CCNC(=O)NC(/C=C\C=C(/C)Br)=C(/C)F |
| InChI | InChI=1S/C11H16BrFN2O/c1-4-14-11(16)15-10(9(3)13)7-5-6-8(2)12/h5-7H,4H2,1-3H3,(H2,14,15,16)/b7-5-,8-6+,10-9- |
| InChIKey | CKWICYQSQYJLDU-GLNSHAOXSA-N |
| XLogP | 3.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.16 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|