About 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene
2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene (PubChem CID 145116718) has the molecular formula C17H36N2
and a molecular weight of 268.49 g/mol. Its IUPAC name is 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene.
Molecular Properties
| Compound Name | 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene |
| PubChem CID | 145116718 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene |
| SMILES | C=C.C=C(CCNC(CC)CN)C1CCCC1.CC |
| InChI | InChI=1S/C13H26N2.C2H6.C2H4/c1-3-13(10-14)15-9-8-11(2)12-6-4-5-7-12;2*1-2/h12-13,15H,2-10,14H2,1H3;1-2H3;1-2H2 |
| InChIKey | LRAKTRBCSMRRAH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene?
The IUPAC name of 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene (CID 145116718) is 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene.
What is the SMILES notation for 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene?
The canonical SMILES for 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene is C=C.C=C(CCNC(CC)CN)C1CCCC1.CC.
What is the InChIKey of 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene?
The InChIKey is LRAKTRBCSMRRAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2.C2H6.C2H4/c1-3-13(10-14)15-9-8-11(2)12-6-4-5-7-12;2*1-2/h12-13,15H,2-10,14H2,1H3;1-2H3;1-2H2.
What are the key properties of 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene?
2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene has a molecular weight of 268.49 g/mol, XLogP of 4.28, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(3-cyclopentylbut-3-enyl)butane-1,2-diamine;ethane;ethene is sourced from PubChem (CID 145116718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).