C36H27N5 — CID 145117212
4-(10-phenylanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine;6-pyridin-2-ylpyridin-2-amine (PubChem CID 145117212) has the molecular formula C36H27N5 and a molecular weight of 529.65 g/mol. Its IUPAC name is 4-(10-phenylanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine;6-pyridin-2-ylpyridin-2-amine.
| Compound Name | 4-(10-phenylanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine;6-pyridin-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 145117212 |
| Molecular Formula | C36H27N5 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 4-(10-phenylanthracen-9-yl)cyclohexa-3,5-diene-1,2-diimine;6-pyridin-2-ylpyridin-2-amine |
| SMILES | Nc1cccc(-c2ccccn2)n1.[H]/N=C1/C=C(c2c3ccccc3c(-c3ccccc3)c3ccccc23)C=C/C1=N\[H] |
| InChI | InChI=1S/C26H18N2.C10H9N3/c27-23-15-14-18(16-24(23)28)26-21-12-6-4-10-19(21)25(17-8-2-1-3-9-17)20-11-5-7-13-22(20)26;11-10-6-3-5-9(13-10)8-4-1-2-7-12-8/h1-16,27-28H;1-7H,(H2,11,13)/b27-23+,28-24-; |
| InChIKey | YQEZBDISAARJAQ-QMDBCWCCSA-N |
| XLogP | 8.38 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|