C23H34N4S — CID 145118219
1-cyclobutyl-4-[4-cyclopropyl-1-(4-propan-2-ylphenyl)sulfanyl-4,5-dihydroimidazol-2-yl]piperazine (PubChem CID 145118219) has the molecular formula C23H34N4S and a molecular weight of 398.62 g/mol. Its IUPAC name is 1-cyclobutyl-4-[4-cyclopropyl-1-(4-propan-2-ylphenyl)sulfanyl-4,5-dihydroimidazol-2-yl]piperazine.
| Compound Name | 1-cyclobutyl-4-[4-cyclopropyl-1-(4-propan-2-ylphenyl)sulfanyl-4,5-dihydroimidazol-2-yl]piperazine |
|---|---|
| PubChem CID | 145118219 |
| Molecular Formula | C23H34N4S |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 1-cyclobutyl-4-[4-cyclopropyl-1-(4-propan-2-ylphenyl)sulfanyl-4,5-dihydroimidazol-2-yl]piperazine |
| SMILES | CC(C)c1ccc(SN2CC(C3CC3)N=C2N2CCN(C3CCC3)CC2)cc1 |
| InChI | InChI=1S/C23H34N4S/c1-17(2)18-8-10-21(11-9-18)28-27-16-22(19-6-7-19)24-23(27)26-14-12-25(13-15-26)20-4-3-5-20/h8-11,17,19-20,22H,3-7,12-16H2,1-2H3 |
| InChIKey | RHBSPDUSAXOUAT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|