About 7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene
7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene (PubChem CID 145118764) has the molecular formula C11H15Br
and a molecular weight of 227.14 g/mol. Its IUPAC name is 7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene.
Analyze 7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene?
The IUPAC name of 7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene (CID 145118764) is 7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene.
What is the SMILES notation for 7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene?
The canonical SMILES for 7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene is CC1CC(Br)=CC2=C1CCCC2.
What is the InChIKey of 7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene?
The InChIKey is LPILIDQQKMBFPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Br/c1-8-6-10(12)7-9-4-2-3-5-11(8)9/h7-8H,2-6H2,1H3.
What are the key properties of 7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene?
7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene has a molecular weight of 227.14 g/mol, XLogP of 4.18, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-methyl-1,2,3,4,5,6-hexahydronaphthalene is sourced from PubChem (CID 145118764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).