About 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine
5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine (PubChem CID 145119182) has the molecular formula C12H21ClN4O
and a molecular weight of 272.78 g/mol. Its IUPAC name is 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine.
Molecular Properties
| Compound Name | 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine |
| PubChem CID | 145119182 |
| Molecular Formula | C12H21ClN4O |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine |
| SMILES | CC1CCCCN1C.Cn1ncc(N)c(Cl)c1=O |
| InChI | InChI=1S/C7H15N.C5H6ClN3O/c1-7-5-3-4-6-8(7)2;1-9-5(10)4(6)3(7)2-8-9/h7H,3-6H2,1-2H3;2H,7H2,1H3 |
| InChIKey | UQSOPAPVXGPVCV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine?
The IUPAC name of 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine (CID 145119182) is 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine.
What is the SMILES notation for 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine?
The canonical SMILES for 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine is CC1CCCCN1C.Cn1ncc(N)c(Cl)c1=O.
What is the InChIKey of 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine?
The InChIKey is UQSOPAPVXGPVCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C5H6ClN3O/c1-7-5-3-4-6-8(7)2;1-9-5(10)4(6)3(7)2-8-9/h7H,3-6H2,1-2H3;2H,7H2,1H3.
What are the key properties of 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine?
5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine has a molecular weight of 272.78 g/mol, XLogP of 1.51, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-chloro-2-methylpyridazin-3-one;1,2-dimethylpiperidine is sourced from PubChem (CID 145119182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).