About 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane
5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane (PubChem CID 145119187) has the molecular formula C15H29ClN4O
and a molecular weight of 316.88 g/mol. Its IUPAC name is 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane.
Molecular Properties
| Compound Name | 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane |
| PubChem CID | 145119187 |
| Molecular Formula | C15H29ClN4O |
| Molecular Weight | 316.88 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane |
| SMILES | CC(C)C.CN1CCCCC1.Cn1ncc(N)c(Cl)c1=O |
| InChI | InChI=1S/C6H13N.C5H6ClN3O.C4H10/c1-7-5-3-2-4-6-7;1-9-5(10)4(6)3(7)2-8-9;1-4(2)3/h2-6H2,1H3;2H,7H2,1H3;4H,1-3H3 |
| InChIKey | PXIJPVAHLCSKMB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.88 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane?
The IUPAC name of 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane (CID 145119187) is 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane.
What is the SMILES notation for 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane?
The canonical SMILES for 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane is CC(C)C.CN1CCCCC1.Cn1ncc(N)c(Cl)c1=O.
What is the InChIKey of 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane?
The InChIKey is PXIJPVAHLCSKMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C5H6ClN3O.C4H10/c1-7-5-3-2-4-6-7;1-9-5(10)4(6)3(7)2-8-9;1-4(2)3/h2-6H2,1H3;2H,7H2,1H3;4H,1-3H3.
What are the key properties of 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane?
5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane has a molecular weight of 316.88 g/mol, XLogP of 2.78, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-chloro-2-methylpyridazin-3-one;1-methylpiperidine;2-methylpropane is sourced from PubChem (CID 145119187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).