About (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine
(3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine (PubChem CID 145119192) has the molecular formula C15H33N3O
and a molecular weight of 271.45 g/mol. Its IUPAC name is (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine.
Molecular Properties
| Compound Name | (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine |
| PubChem CID | 145119192 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine |
| SMILES | COCCN1CCCC(N)C1.C[C@@H]1CCCN(C)C1 |
| InChI | InChI=1S/C8H18N2O.C7H15N/c1-11-6-5-10-4-2-3-8(9)7-10;1-7-4-3-5-8(2)6-7/h8H,2-7,9H2,1H3;7H,3-6H2,1-2H3/t;7-/m.1/s1 |
| InChIKey | KFFNCHVEQHFRPW-HMZWWLAASA-N |
| XLogP | 1.40 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine?
The IUPAC name of (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine (CID 145119192) is (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine.
What is the SMILES notation for (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine?
The canonical SMILES for (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine is COCCN1CCCC(N)C1.C[C@@H]1CCCN(C)C1.
What is the InChIKey of (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine?
The InChIKey is KFFNCHVEQHFRPW-HMZWWLAASA-N. The full InChI is InChI=1S/C8H18N2O.C7H15N/c1-11-6-5-10-4-2-3-8(9)7-10;1-7-4-3-5-8(2)6-7/h8H,2-7,9H2,1H3;7H,3-6H2,1-2H3/t;7-/m.1/s1.
What are the key properties of (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine?
(3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine has a molecular weight of 271.45 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1,3-dimethylpiperidine;1-(2-methoxyethyl)piperidin-3-amine is sourced from PubChem (CID 145119192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).