C16H26N2 — CID 145119279
4-[[(3R)-3-ethylpiperidin-1-yl]methyl]-N,N-dimethylaniline (PubChem CID 145119279) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 4-[[(3R)-3-ethylpiperidin-1-yl]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[(3R)-3-ethylpiperidin-1-yl]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 145119279 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 4-[[(3R)-3-ethylpiperidin-1-yl]methyl]-N,N-dimethylaniline |
| SMILES | CC[C@@H]1CCCN(Cc2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C16H26N2/c1-4-14-6-5-11-18(12-14)13-15-7-9-16(10-8-15)17(2)3/h7-10,14H,4-6,11-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | XQSULNLGBIOSIN-CQSZACIVSA-N |
| XLogP | 3.37 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|