About ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine
ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine (PubChem CID 145119797) has the molecular formula C14H28N2O
and a molecular weight of 240.39 g/mol. Its IUPAC name is ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine.
Molecular Properties
| Compound Name | ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine |
| PubChem CID | 145119797 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine |
| SMILES | C=C/C=C(\C)OCCCN1CCNCC1.CC |
| InChI | InChI=1S/C12H22N2O.C2H6/c1-3-5-12(2)15-11-4-8-14-9-6-13-7-10-14;1-2/h3,5,13H,1,4,6-11H2,2H3;1-2H3/b12-5+; |
| InChIKey | GPMATYIMFNKPLV-NKPNRJPBSA-N |
| XLogP | 2.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine?
The IUPAC name of ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine (CID 145119797) is ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine.
What is the SMILES notation for ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine?
The canonical SMILES for ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine is C=C/C=C(\C)OCCCN1CCNCC1.CC.
What is the InChIKey of ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine?
The InChIKey is GPMATYIMFNKPLV-NKPNRJPBSA-N. The full InChI is InChI=1S/C12H22N2O.C2H6/c1-3-5-12(2)15-11-4-8-14-9-6-13-7-10-14;1-2/h3,5,13H,1,4,6-11H2,2H3;1-2H3/b12-5+;.
What are the key properties of ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine?
ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine has a molecular weight of 240.39 g/mol, XLogP of 2.41, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[3-[(2E)-penta-2,4-dien-2-yl]oxypropyl]piperazine is sourced from PubChem (CID 145119797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).