C32H42N5O5+ — CID 145120838
2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-N-hexyl-1-(2-hydroxyethyl)-6-(3-hydroxypyrrolidin-1-yl)-N-methylbenzimidazol-1-ium-5-carboxamide (PubChem CID 145120838) has the molecular formula C32H42N5O5+ and a molecular weight of 576.72 g/mol. Its IUPAC name is 2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-N-hexyl-1-(2-hydroxyethyl)-6-(3-hydroxypyrrolidin-1-yl)-N-methylbenzimidazol-1-ium-5-carboxamide.
| Compound Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-N-hexyl-1-(2-hydroxyethyl)-6-(3-hydroxypyrrolidin-1-yl)-N-methylbenzimidazol-1-ium-5-carboxamide |
|---|---|
| PubChem CID | 145120838 |
| Molecular Formula | C32H42N5O5+ |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.32 |
| IUPAC Name | 2-[(1,3-dioxoisoindol-2-yl)methyl]-3-ethyl-N-hexyl-1-(2-hydroxyethyl)-6-(3-hydroxypyrrolidin-1-yl)-N-methylbenzimidazol-1-ium-5-carboxamide |
| SMILES | CCCCCCN(C)C(=O)c1cc2c(cc1N1CCC(O)C1)[n+](CCO)c(CN1C(=O)c3ccccc3C1=O)n2CC |
| InChI | InChI=1S/C32H42N5O5/c1-4-6-7-10-14-33(3)30(40)25-18-27-28(19-26(25)34-15-13-22(39)20-34)36(16-17-38)29(35(27)5-2)21-37-31(41)23-11-8-9-12-24(23)32(37)42/h8-9,11-12,18-19,22,38-39H,4-7,10,13-17,20-21H2,1-3H3/q+1 |
| InChIKey | DHKQGSYBGUCPMX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 110.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|