C17H13F5N4O2 — CID 145121080
5-(3,4-dimethylphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)-2-(1H-pyrazol-5-yl)-1H-pyrimidin-6-one (PubChem CID 145121080) has the molecular formula C17H13F5N4O2 and a molecular weight of 400.31 g/mol. Its IUPAC name is 5-(3,4-dimethylphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)-2-(1H-pyrazol-5-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-(3,4-dimethylphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)-2-(1H-pyrazol-5-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 145121080 |
| Molecular Formula | C17H13F5N4O2 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 5-(3,4-dimethylphenoxy)-4-(1,1,2,2,2-pentafluoroethyl)-2-(1H-pyrazol-5-yl)-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(Oc2c(C(F)(F)C(F)(F)F)nc(-c3ccn[nH]3)[nH]c2=O)cc1C |
| InChI | InChI=1S/C17H13F5N4O2/c1-8-3-4-10(7-9(8)2)28-12-13(16(18,19)17(20,21)22)24-14(25-15(12)27)11-5-6-23-26-11/h3-7H,1-2H3,(H,23,26)(H,24,25,27) |
| InChIKey | SATJIPVQGKCTEX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|