About 2-(3-methylbutylimino)-1,3-thiazinan-4-one
2-(3-methylbutylimino)-1,3-thiazinan-4-one (PubChem CID 145121137) has the molecular formula C9H16N2OS
and a molecular weight of 200.31 g/mol. Its IUPAC name is 2-(3-methylbutylimino)-1,3-thiazinan-4-one.
Molecular Properties
| Compound Name | 2-(3-methylbutylimino)-1,3-thiazinan-4-one |
| PubChem CID | 145121137 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-(3-methylbutylimino)-1,3-thiazinan-4-one |
| SMILES | CC(C)CC/N=C1/NC(=O)CCS1 |
| InChI | InChI=1S/C9H16N2OS/c1-7(2)3-5-10-9-11-8(12)4-6-13-9/h7H,3-6H2,1-2H3,(H,10,11,12) |
| InChIKey | ZAZQZNWYNHWVIN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylbutylimino)-1,3-thiazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbutylimino)-1,3-thiazinan-4-one?
The IUPAC name of 2-(3-methylbutylimino)-1,3-thiazinan-4-one (CID 145121137) is 2-(3-methylbutylimino)-1,3-thiazinan-4-one.
What is the SMILES notation for 2-(3-methylbutylimino)-1,3-thiazinan-4-one?
The canonical SMILES for 2-(3-methylbutylimino)-1,3-thiazinan-4-one is CC(C)CC/N=C1/NC(=O)CCS1.
What is the InChIKey of 2-(3-methylbutylimino)-1,3-thiazinan-4-one?
The InChIKey is ZAZQZNWYNHWVIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2OS/c1-7(2)3-5-10-9-11-8(12)4-6-13-9/h7H,3-6H2,1-2H3,(H,10,11,12).
What are the key properties of 2-(3-methylbutylimino)-1,3-thiazinan-4-one?
2-(3-methylbutylimino)-1,3-thiazinan-4-one has a molecular weight of 200.31 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbutylimino)-1,3-thiazinan-4-one is sourced from PubChem (CID 145121137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).