About methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate
methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate (PubChem CID 145121158) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate.
Molecular Properties
| Compound Name | methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate |
| PubChem CID | 145121158 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate |
| SMILES | COC(=O)CC(CN)c1cnc(C)o1 |
| InChI | InChI=1S/C9H14N2O3/c1-6-11-5-8(14-6)7(4-10)3-9(12)13-2/h5,7H,3-4,10H2,1-2H3 |
| InChIKey | KHPRQHKWBMRBPQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate?
The IUPAC name of methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate (CID 145121158) is methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate.
What is the SMILES notation for methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate?
The canonical SMILES for methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate is COC(=O)CC(CN)c1cnc(C)o1.
What is the InChIKey of methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate?
The InChIKey is KHPRQHKWBMRBPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c1-6-11-5-8(14-6)7(4-10)3-9(12)13-2/h5,7H,3-4,10H2,1-2H3.
What are the key properties of methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate?
methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate has a molecular weight of 198.22 g/mol, XLogP of 0.59, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3-(2-methyl-1,3-oxazol-5-yl)butanoate is sourced from PubChem (CID 145121158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).