C32H33F2N3O2S — CID 145121575
N-cyclopropylsulfanyl-4-(7,8-difluoro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-1-(2,2-diphenylacetyl)pyrrolidine-2-carboxamide (PubChem CID 145121575) has the molecular formula C32H33F2N3O2S and a molecular weight of 561.70 g/mol. Its IUPAC name is N-cyclopropylsulfanyl-4-(7,8-difluoro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-1-(2,2-diphenylacetyl)pyrrolidine-2-carboxamide.
| Compound Name | N-cyclopropylsulfanyl-4-(7,8-difluoro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-1-(2,2-diphenylacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 145121575 |
| Molecular Formula | C32H33F2N3O2S |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | N-cyclopropylsulfanyl-4-(7,8-difluoro-2,3,4,5-tetrahydro-1-benzazepin-1-yl)-1-(2,2-diphenylacetyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NSC1CC1)C1CC(N2CCCCc3cc(F)c(F)cc32)CN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H33F2N3O2S/c33-26-17-23-13-7-8-16-36(28(23)19-27(26)34)24-18-29(31(38)35-40-25-14-15-25)37(20-24)32(39)30(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-6,9-12,17,19,24-25,29-30H,7-8,13-16,18,20H2,(H,35,38) |
| InChIKey | ROPOVAABRZPUBM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|