C36H50O2 — CID 145121897
[(2E,6Z,10Z,14Z)-2-but-1-en-2-yl-6-ethyl-10,13,13,16-tetramethyl-4,5,8,9,12-pentamethylideneheptadeca-2,6,10,14-tetraenyl] 2-methylprop-2-enoate (PubChem CID 145121897) has the molecular formula C36H50O2 and a molecular weight of 514.79 g/mol. Its IUPAC name is [(2E,6Z,10Z,14Z)-2-but-1-en-2-yl-6-ethyl-10,13,13,16-tetramethyl-4,5,8,9,12-pentamethylideneheptadeca-2,6,10,14-tetraenyl] 2-methylprop-2-enoate.
| Compound Name | [(2E,6Z,10Z,14Z)-2-but-1-en-2-yl-6-ethyl-10,13,13,16-tetramethyl-4,5,8,9,12-pentamethylideneheptadeca-2,6,10,14-tetraenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145121897 |
| Molecular Formula | C36H50O2 |
| Molecular Weight | 514.79 g/mol |
| Exact Mass | 514.38 |
| IUPAC Name | [(2E,6Z,10Z,14Z)-2-but-1-en-2-yl-6-ethyl-10,13,13,16-tetramethyl-4,5,8,9,12-pentamethylideneheptadeca-2,6,10,14-tetraenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC/C(=C/C(=C)C(=C)/C(=C\C(=C)C(=C)/C(C)=C\C(=C)C(C)(C)/C=C\C(C)C)CC)C(=C)CC |
| InChI | InChI=1S/C36H50O2/c1-16-26(7)34(23-38-35(37)25(5)6)22-29(10)32(13)33(17-2)21-28(9)31(12)27(8)20-30(11)36(14,15)19-18-24(3)4/h18-22,24H,5,7,9-13,16-17,23H2,1-4,6,8,14-15H3/b19-18-,27-20-,33-21-,34-22- |
| InChIKey | UXTBZFDFMIFUSS-JTJVJRQKSA-N |
| XLogP | 10.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.79 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|