C27H39FO3 — CID 145121898
(3R)-3-[(3E,7Z)-4-fluoro-9-methoxy-7-(2-methoxyethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;formaldehyde;prop-1-ene (PubChem CID 145121898) has the molecular formula C27H39FO3 and a molecular weight of 430.60 g/mol. Its IUPAC name is (3R)-3-[(3E,7Z)-4-fluoro-9-methoxy-7-(2-methoxyethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;formaldehyde;prop-1-ene.
| Compound Name | (3R)-3-[(3E,7Z)-4-fluoro-9-methoxy-7-(2-methoxyethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;formaldehyde;prop-1-ene |
|---|---|
| PubChem CID | 145121898 |
| Molecular Formula | C27H39FO3 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | (3R)-3-[(3E,7Z)-4-fluoro-9-methoxy-7-(2-methoxyethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene;formaldehyde;prop-1-ene |
| SMILES | C=C(/C=C(/CCOC)C(=C)C(=C)/C(F)=C\C(=C)[C@@]1(C)C=CC(C)C1)OC.C=CC.C=O |
| InChI | InChI=1S/C23H31FO2.C3H6.CH2O/c1-16-9-11-23(6,15-16)17(2)13-22(24)20(5)19(4)21(10-12-25-7)14-18(3)26-8;1-3-2;1-2/h9,11,13-14,16H,2-5,10,12,15H2,1,6-8H3;3H,1H2,2H3;1H2/b21-14-,22-13+;;/t16?,23-;;/m0../s1 |
| InChIKey | FHIRAKRURDAULT-UKVMNYTOSA-N |
| XLogP | 7.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|