C23H31FO2 — CID 145121899
(3R)-3-[(3E,7Z)-4-fluoro-9-methoxy-7-(2-methoxyethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene (PubChem CID 145121899) has the molecular formula C23H31FO2 and a molecular weight of 358.50 g/mol. Its IUPAC name is (3R)-3-[(3E,7Z)-4-fluoro-9-methoxy-7-(2-methoxyethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene.
| Compound Name | (3R)-3-[(3E,7Z)-4-fluoro-9-methoxy-7-(2-methoxyethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene |
|---|---|
| PubChem CID | 145121899 |
| Molecular Formula | C23H31FO2 |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (3R)-3-[(3E,7Z)-4-fluoro-9-methoxy-7-(2-methoxyethyl)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-3,5-dimethylcyclopentene |
| SMILES | C=C(/C=C(/CCOC)C(=C)C(=C)/C(F)=C\C(=C)[C@@]1(C)C=CC(C)C1)OC |
| InChI | InChI=1S/C23H31FO2/c1-16-9-11-23(6,15-16)17(2)13-22(24)20(5)19(4)21(10-12-25-7)14-18(3)26-8/h9,11,13-14,16H,2-5,10,12,15H2,1,6-8H3/b21-14-,22-13+/t16?,23-/m0/s1 |
| InChIKey | MFKDNVRSSNFIOC-RQAOAXTQSA-N |
| XLogP | 6.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|