C28H46O3 — CID 145121916
ethane;[(3E,7Z)-7-ethyl-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-trien-3-yl] formate;prop-1-ene (PubChem CID 145121916) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is ethane;[(3E,7Z)-7-ethyl-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-trien-3-yl] formate;prop-1-ene.
| Compound Name | ethane;[(3E,7Z)-7-ethyl-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-trien-3-yl] formate;prop-1-ene |
|---|---|
| PubChem CID | 145121916 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | ethane;[(3E,7Z)-7-ethyl-2-methoxy-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-trien-3-yl] formate;prop-1-ene |
| SMILES | C=C(/C=C(\OC=O)C(=C)OC)C(=C)/C(=C\C(=C)C(C)CCC(C)C)CC.C=CC.CC |
| InChI | InChI=1S/C23H34O3.C3H6.C2H6/c1-10-22(13-18(5)17(4)12-11-16(2)3)20(7)19(6)14-23(26-15-24)21(8)25-9;1-3-2;1-2/h13-17H,5-8,10-12H2,1-4,9H3;3H,1H2,2H3;1-2H3/b22-13-,23-14+;; |
| InChIKey | WKBWKZSADYIPDS-NCEBCISWSA-N |
| XLogP | 8.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|