C27H36O4 — CID 145121956
2-[(3E,7Z)-9-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-7-ethyl-2-methoxy-5,6-dimethylidenedeca-1,3,7,9-tetraen-3-yl]oxyethyl prop-2-enoate (PubChem CID 145121956) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is 2-[(3E,7Z)-9-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-7-ethyl-2-methoxy-5,6-dimethylidenedeca-1,3,7,9-tetraen-3-yl]oxyethyl prop-2-enoate.
| Compound Name | 2-[(3E,7Z)-9-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-7-ethyl-2-methoxy-5,6-dimethylidenedeca-1,3,7,9-tetraen-3-yl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 145121956 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 2-[(3E,7Z)-9-[(1R)-1,4-dimethylcyclopent-2-en-1-yl]-7-ethyl-2-methoxy-5,6-dimethylidenedeca-1,3,7,9-tetraen-3-yl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCO/C(=C\C(=C)C(=C)/C(=C\C(=C)[C@@]1(C)C=CC(C)C1)CC)C(=C)OC |
| InChI | InChI=1S/C27H36O4/c1-10-24(17-21(5)27(8)13-12-19(3)18-27)22(6)20(4)16-25(23(7)29-9)30-14-15-31-26(28)11-2/h11-13,16-17,19H,2,4-7,10,14-15,18H2,1,3,8-9H3/b24-17-,25-16+/t19?,27-/m0/s1 |
| InChIKey | IMCMAJMOYOIBRV-ZLBSWTAQSA-N |
| XLogP | 6.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|