C29H41FO3 — CID 145121969
(3E,7E,11Z)-8-fluoro-2-methoxy-3-(2-methoxyethoxy)-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene (PubChem CID 145121969) has the molecular formula C29H41FO3 and a molecular weight of 456.64 g/mol. Its IUPAC name is (3E,7E,11Z)-8-fluoro-2-methoxy-3-(2-methoxyethoxy)-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene.
| Compound Name | (3E,7E,11Z)-8-fluoro-2-methoxy-3-(2-methoxyethoxy)-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 145121969 |
| Molecular Formula | C29H41FO3 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | (3E,7E,11Z)-8-fluoro-2-methoxy-3-(2-methoxyethoxy)-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11-tetraene |
| SMILES | C=C(/C=C(\F)C(=C)C(=C)/C=C\C(=C)C(C)CCC(C)C)C(=C)/C=C(\OCCOC)C(=C)OC |
| InChI | InChI=1S/C29H41FO3/c1-20(2)12-13-21(3)22(4)14-15-23(5)26(8)28(30)18-24(6)25(7)19-29(27(9)32-11)33-17-16-31-10/h14-15,18-21H,4-9,12-13,16-17H2,1-3,10-11H3/b15-14-,28-18+,29-19+ |
| InChIKey | NJSLXZYJNGIIHE-IDCIMGFRSA-N |
| XLogP | 7.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|