C34H58O4 — CID 145121994
formaldehyde;(4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidene-15-(2-methylpropoxy)hexadeca-4,8-diene;2-methylprop-1-ene (PubChem CID 145121994) has the molecular formula C34H58O4 and a molecular weight of 530.83 g/mol. Its IUPAC name is formaldehyde;(4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidene-15-(2-methylpropoxy)hexadeca-4,8-diene;2-methylprop-1-ene.
| Compound Name | formaldehyde;(4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidene-15-(2-methylpropoxy)hexadeca-4,8-diene;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145121994 |
| Molecular Formula | C34H58O4 |
| Molecular Weight | 530.83 g/mol |
| Exact Mass | 530.43 |
| IUPAC Name | formaldehyde;(4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidene-15-(2-methylpropoxy)hexadeca-4,8-diene;2-methylprop-1-ene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C(C)OCC(C)C)C(=C)/C=C(/OCCOC)C(=C)CC.C=C(C)C.C=O |
| InChI | InChI=1S/C29H48O3.C4H8.CH2O/c1-12-22(4)29(31-18-17-30-11)19-27(9)25(7)14-13-23(5)24(6)15-16-26(8)28(10)32-20-21(2)3;1-4(2)3;1-2/h13-14,19,21,24,26,28H,4-5,7,9,12,15-18,20H2,1-3,6,8,10-11H3;1H2,2-3H3;1H2/b14-13-,29-19+;; |
| InChIKey | RWOFCCWJVWWNKX-FAIMZCIUSA-N |
| XLogP | 9.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.83 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|