C29H48O3 — CID 145121995
(4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidene-15-(2-methylpropoxy)hexadeca-4,8-diene (PubChem CID 145121995) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is (4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidene-15-(2-methylpropoxy)hexadeca-4,8-diene.
| Compound Name | (4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidene-15-(2-methylpropoxy)hexadeca-4,8-diene |
|---|---|
| PubChem CID | 145121995 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | (4E,8Z)-4-(2-methoxyethoxy)-11,14-dimethyl-3,6,7,10-tetramethylidene-15-(2-methylpropoxy)hexadeca-4,8-diene |
| SMILES | C=C(/C=C\C(=C)C(C)CCC(C)C(C)OCC(C)C)C(=C)/C=C(/OCCOC)C(=C)CC |
| InChI | InChI=1S/C29H48O3/c1-12-22(4)29(31-18-17-30-11)19-27(9)25(7)14-13-23(5)24(6)15-16-26(8)28(10)32-20-21(2)3/h13-14,19,21,24,26,28H,4-5,7,9,12,15-18,20H2,1-3,6,8,10-11H3/b14-13-,29-19+ |
| InChIKey | HJBMCHGVCVJQIF-ZUNHXWJDSA-N |
| XLogP | 7.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|