C29H44O2 — CID 145122017
ethane;(3R)-3-[(3Z,7Z)-4-(2-methoxyethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;prop-2-enal (PubChem CID 145122017) has the molecular formula C29H44O2 and a molecular weight of 424.67 g/mol. Its IUPAC name is ethane;(3R)-3-[(3Z,7Z)-4-(2-methoxyethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;prop-2-enal.
| Compound Name | ethane;(3R)-3-[(3Z,7Z)-4-(2-methoxyethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;prop-2-enal |
|---|---|
| PubChem CID | 145122017 |
| Molecular Formula | C29H44O2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | ethane;(3R)-3-[(3Z,7Z)-4-(2-methoxyethyl)-5,6,9-trimethylideneundeca-1,3,7-trien-2-yl]-3,5-dimethylcyclopentene;prop-2-enal |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(=C\C(=C)[C@@]1(C)C=CC(C)C1)CCOC)CC.C=CC=O.CC |
| InChI | InChI=1S/C24H34O.C3H4O.C2H6/c1-9-18(2)10-11-20(4)22(6)23(13-15-25-8)16-21(5)24(7)14-12-19(3)17-24;1-2-3-4;1-2/h10-12,14,16,19H,2,4-6,9,13,15,17H2,1,3,7-8H3;2-3H,1H2;1-2H3/b11-10-,23-16-;;/t19?,24-;;/m0../s1 |
| InChIKey | ANNFKIGLSKDSBZ-GHDAGVBISA-N |
| XLogP | 8.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|